CAS 952433-96-4 is the registry number for 1,8-Dimethylchrysene. Offered by: TRC. Available pack sizes: 250mg.
1,8-dimethylchrysene (CAS 952433-96-4) is a chemical compound with the molecular formula C20H16 and a molecular weight of 256.3 g/mol. IUPAC name: 1,8-dimethylchrysene. InChIKey: GKWJQUJZSZEJMO-UHFFFAOYSA-N.
| Molecular formula | C20H16 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 1,8-dimethylchrysene |
| InChIKey | GKWJQUJZSZEJMO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=C(C=C2)C4=CC=CC(=C4C=C3)C |
Computed by PubChem (NCBI)