Products 15936-73-9
CAS 15936-73-9 is the registry number for Ethyl 5-bromo-7-methyl-1H-indole-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 5-bromo-7-methyl-1H-indole-2-carboxylate (CAS 15936-73-9) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: ethyl 5-bromo-7-methyl-1H-indole-2-carboxylate. InChIKey: UWTGCTJNYQKJAW-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | ethyl 5-bromo-7-methyl-1H-indole-2-carboxylate |
| InChIKey | UWTGCTJNYQKJAW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C(=CC(=C2)Br)C |
Computed by PubChem (NCBI)