CAS 6630-73-5 is the registry number for 4-(2-Chloroacetyl)-1,5-dimethyl-2-phenyl-1H-pyrazol-3(2H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-chloroacetyl)-1,5-dimethyl-2-phenylpyrazol-3-one (CAS 6630-73-5) is a chemical compound with the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. IUPAC name: 4-(2-chloroacetyl)-1,5-dimethyl-2-phenylpyrazol-3-one. InChIKey: QGWUTAPXLRKROO-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2 |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | 4-(2-chloroacetyl)-1,5-dimethyl-2-phenylpyrazol-3-one |
| InChIKey | QGWUTAPXLRKROO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)C(=O)CCl |
Computed by PubChem (NCBI)