CAS 15944-34-0 appears in our catalog under these names: 7-Chloro-1,8-naphthyridin-2-ol, 98%, 7-Chloro-1H-1,8-naphthyridin-2-one, 97%, 7-Chloro-1,8-naphthyridin-2-ol, 97%, 7–Chloro–1,8–naphthyridin–2–ol, 7-Chloro-1,8-naphthyridin-2-ol. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
7-chloro-1H-1,8-naphthyridin-2-one (CAS 15944-34-0) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 7-chloro-1H-1,8-naphthyridin-2-one. InChIKey: VOFMYNBQUTUEOS-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 7-chloro-1H-1,8-naphthyridin-2-one |
| InChIKey | VOFMYNBQUTUEOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=C1C=CC(=N2)Cl |
Computed by PubChem (NCBI)