CAS 1594854-44-0 is the registry number for Methyl 8-chloro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 8-chloro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate (CAS 1594854-44-0) is a chemical compound with the molecular formula C8H6ClN3O2 and a molecular weight of 211.60 g/mol. IUPAC name: methyl 8-chloro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate. InChIKey: ASVYHFDFXYKZKY-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | methyl 8-chloro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate |
| InChIKey | ASVYHFDFXYKZKY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C=NN=C2C(=C1)Cl |
Computed by PubChem (NCBI)