Products 1595078-09-3
CAS 1595078-09-3 is the registry number for 2-(2-Bromo-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(2-bromo-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1595078-09-3) is a chemical compound with the molecular formula C12H14BBrF2O2 and a molecular weight of 318.95 g/mol. IUPAC name: 2-(2-bromo-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YUTOIYRTZAPVLV-UHFFFAOYSA-N.
| Molecular formula | C12H14BBrF2O2 |
|---|---|
| Molecular weight | 318.95 g/mol |
| IUPAC name | 2-(2-bromo-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YUTOIYRTZAPVLV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2Br)F)F |
Computed by PubChem (NCBI)