CAS 159832-34-5 appears in our catalog under these names: 3-(Benzyloxy)-4-hydroxybenzoic acid, 95%, 3–(benzyloxy)–4–hydroxybenzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-hydroxy-3-phenylmethoxybenzoic acid (CAS 159832-34-5) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 4-hydroxy-3-phenylmethoxybenzoic acid. InChIKey: YEFZIBGGMNFCBS-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 4-hydroxy-3-phenylmethoxybenzoic acid |
| InChIKey | YEFZIBGGMNFCBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)C(=O)O)O |
Computed by PubChem (NCBI)