CAS 159990-12-2 appears in our catalog under these names: Boc-(s)-3-amino-3-(4-methoxy-phenyl)-propionic acid, 95%, (S)-3-((tert-Butoxycarbonyl)amino)-3-(4-methoxyphenyl)propanoic acid, 98%, 98%, (S)-3-((tert-Butoxycarbonyl)amino)-3-(4-methoxyphenyl)propanoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 100mg, 250mg, 5g.
(3S)-3-(4-methoxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 159990-12-2) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: (3S)-3-(4-methoxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: OPAAZWPTEYZZIW-LBPRGKRZSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | (3S)-3-(4-methoxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | OPAAZWPTEYZZIW-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)