Products 160001-94-5
CAS 160001-94-5 is the registry number for 1-(4-tert-Butylphenyl)cyclopentan-1-amine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(4-tert-butylphenyl)cyclopentan-1-amine (CAS 160001-94-5) is a chemical compound with the molecular formula C15H23N and a molecular weight of 217.35 g/mol. IUPAC name: 1-(4-tert-butylphenyl)cyclopentan-1-amine. InChIKey: PMTBIPCGTQPLGH-UHFFFAOYSA-N.
| Molecular formula | C15H23N |
|---|---|
| Molecular weight | 217.35 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)cyclopentan-1-amine |
| InChIKey | PMTBIPCGTQPLGH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2(CCCC2)N |
Computed by PubChem (NCBI)