Products 160098-78-2
CAS 160098-78-2 is the registry number for Cryptofolione. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
(2R)-2-[(1E,4S,6R,7E)-4,6-dihydroxy-8-phenylocta-1,7-dienyl]-2,3-dihydropyran-6-one (CAS 160098-78-2) is a chemical compound with the molecular formula C19H22O4 and a molecular weight of 314.4 g/mol. IUPAC name: (2R)-2-[(1E,4S,6R,7E)-4,6-dihydroxy-8-phenylocta-1,7-dienyl]-2,3-dihydropyran-6-one. InChIKey: JSKFCRSAYKODTM-RURAAYBUSA-N.
| Molecular formula | C19H22O4 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (2R)-2-[(1E,4S,6R,7E)-4,6-dihydroxy-8-phenylocta-1,7-dienyl]-2,3-dihydropyran-6-one |
| InChIKey | JSKFCRSAYKODTM-RURAAYBUSA-N |
| SMILES | C1C=CC(=O)O[C@H]1/C=C/C[C@@H](C[C@H](/C=C/C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)
Synonyms:
Cryptofolione, orb1682884