CAS 1601-82-7 is the registry number for trans-2-Benzoylcyclopropanecarboxylic acid 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
Trans-(1R,2R)-2-benzoylcyclopropane-1-carboxylic acid (CAS 1601-82-7) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: trans-(1R,2R)-2-benzoylcyclopropane-1-carboxylic acid. InChIKey: LKZSGYYDOQYLNR-RKDXNWHRSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | trans-(1R,2R)-2-benzoylcyclopropane-1-carboxylic acid |
| InChIKey | LKZSGYYDOQYLNR-RKDXNWHRSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)