CAS 1601768-68-6 is the registry number for 2-Bromo-5,7-dimethoxyquinoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5,7-dimethoxyquinoline (CAS 1601768-68-6) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 2-bromo-5,7-dimethoxyquinoline. InChIKey: MQKFQRPDSQHJIV-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 2-bromo-5,7-dimethoxyquinoline |
| InChIKey | MQKFQRPDSQHJIV-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CC(=N2)Br)C(=C1)OC |
Computed by PubChem (NCBI)