CAS 160204-35-3 is the registry number for 3,3-Dimethyl-1-phenylbutan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,3-dimethyl-1-phenylbutan-2-amine;hydrochloride (CAS 160204-35-3) is a chemical compound with the molecular formula C12H20ClN and a molecular weight of 213.75 g/mol. IUPAC name: 3,3-dimethyl-1-phenylbutan-2-amine;hydrochloride. InChIKey: WGZWZDYJOMTUMF-UHFFFAOYSA-N.
| Molecular formula | C12H20ClN |
|---|---|
| Molecular weight | 213.75 g/mol |
| IUPAC name | 3,3-dimethyl-1-phenylbutan-2-amine;hydrochloride |
| InChIKey | WGZWZDYJOMTUMF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)