CAS 16024-43-4 appears in our catalog under these names: 3-Methoxy-O,a-dimethyl-tyrosine Hydrochloride, 3-Methoxy-O,Alpha-dimethyl-tyrosine Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid;hydrochloride (CAS 16024-43-4) is a chemical compound with the molecular formula C12H18ClNO4 and a molecular weight of 275.73 g/mol. IUPAC name: 2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid;hydrochloride. InChIKey: MBKUFCLQPYLOCC-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO4 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | 2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid;hydrochloride |
| InChIKey | MBKUFCLQPYLOCC-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)OC)OC)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)