CAS 2508-79-4 appears in our catalog under these names: Methyldopate, Methyldopate Hydrochloride, METHYLDOPATE HYDROCHLORIDE, BRITISH PHAR, Methyldopate (hydrochloride). Offered by: TRC, LoGiCal, Sigma-Aldrich, MedChemExpress. Available pack sizes: 2,5g, 250mg, 5mg, 1EA, 25mg, 50mg.
Ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate;hydrochloride (CAS 2508-79-4) is a chemical compound with the molecular formula C12H18ClNO4 and a molecular weight of 275.73 g/mol. IUPAC name: ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate;hydrochloride. InChIKey: QSRVZCCJDKYRRF-YDALLXLXSA-N.
| Molecular formula | C12H18ClNO4 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate;hydrochloride |
| InChIKey | QSRVZCCJDKYRRF-YDALLXLXSA-N |
| SMILES | CCOC(=O)[C@](C)(CC1=CC(=C(C=C1)O)O)N.Cl |
Computed by PubChem (NCBI)