CAS 70494-48-3 appears in our catalog under these names: (S)-3,4-Dimethoxyphenylalanine methyl ester hydrochloride, 95%, (S)-Methyl 2-amino-3-(3,4-dimethoxyphenyl)propanoate hydrochloride, 97%, (S)–Methyl 2–amino–3–(3,4–dimethoxyphenyl)propanoate hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
Methyl (2S)-2-amino-3-(3,4-dimethoxyphenyl)propanoate;hydrochloride (CAS 70494-48-3) is a chemical compound with the molecular formula C12H18ClNO4 and a molecular weight of 275.73 g/mol. IUPAC name: methyl (2S)-2-amino-3-(3,4-dimethoxyphenyl)propanoate;hydrochloride. InChIKey: ZAKAXTBGALLXCW-FVGYRXGTSA-N.
| Molecular formula | C12H18ClNO4 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(3,4-dimethoxyphenyl)propanoate;hydrochloride |
| InChIKey | ZAKAXTBGALLXCW-FVGYRXGTSA-N |
| SMILES | COC1=C(C=C(C=C1)C[C@@H](C(=O)OC)N)OC.Cl |
Computed by PubChem (NCBI)