CAS 5486-79-3 appears in our catalog under these names: L-alpha-Methyl DOPA Dimethyl Ether Hydrochloride, (S)-2-Amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid hydrochloride, 95%, 95%. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 250mg, 1g.
(2S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid;hydrochloride (CAS 5486-79-3) is a chemical compound with the molecular formula C12H18ClNO4 and a molecular weight of 275.73 g/mol. IUPAC name: (2S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid;hydrochloride. InChIKey: MBKUFCLQPYLOCC-YDALLXLXSA-N.
| Molecular formula | C12H18ClNO4 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | (2S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid;hydrochloride |
| InChIKey | MBKUFCLQPYLOCC-YDALLXLXSA-N |
| SMILES | C[C@](CC1=CC(=C(C=C1)OC)OC)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)