CAS 39740-31-3 is the registry number for L-DOPA Isopropyl Ester Hydrochloride. Offered by: TRC. Available pack sizes: 2,5g.
Propan-2-yl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride (CAS 39740-31-3) is a chemical compound with the molecular formula C12H18ClNO4 and a molecular weight of 275.73 g/mol. IUPAC name: propan-2-yl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride. InChIKey: DOUYNJGVDZBRDU-FVGYRXGTSA-N.
| Molecular formula | C12H18ClNO4 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | propan-2-yl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride |
| InChIKey | DOUYNJGVDZBRDU-FVGYRXGTSA-N |
| SMILES | CC(C)OC(=O)[C@H](CC1=CC(=C(C=C1)O)O)N.Cl |
Computed by PubChem (NCBI)