CAS 1602857-63-5 is the registry number for 2-Amino-4,5-dibromobenzaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-amino-4,5-dibromobenzaldehyde (CAS 1602857-63-5) is a chemical compound with the molecular formula C7H5Br2NO and a molecular weight of 278.93 g/mol. IUPAC name: 2-amino-4,5-dibromobenzaldehyde. InChIKey: YDYMZJIPRFDIJK-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO |
|---|---|
| Molecular weight | 278.93 g/mol |
| IUPAC name | 2-amino-4,5-dibromobenzaldehyde |
| InChIKey | YDYMZJIPRFDIJK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)N)C=O |
Computed by PubChem (NCBI)