CAS 1605250-53-0 appears in our catalog under these names: (3S)-1-(Benzenesulfonyl)pyrrolidin-3-amine hydrochloride, (S)-1-(Phenylsulfonyl)pyrrolidin-3-amine hydrochloride, 98%, 98%, (S)-1-(Phenylsulfonyl)pyrrolidin-3-amine hydrochloride, 98%, (S)-1-(Phenylsulfonyl)pyrrolidin-3-amine hydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g.
(3S)-1-(benzenesulfonyl)pyrrolidin-3-amine;hydrochloride (CAS 1605250-53-0) is a chemical compound with the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. IUPAC name: (3S)-1-(benzenesulfonyl)pyrrolidin-3-amine;hydrochloride. InChIKey: RSQZDZRDQAZTRG-FVGYRXGTSA-N.
| Molecular formula | C10H15ClN2O2S |
|---|---|
| Molecular weight | 262.76 g/mol |
| IUPAC name | (3S)-1-(benzenesulfonyl)pyrrolidin-3-amine;hydrochloride |
| InChIKey | RSQZDZRDQAZTRG-FVGYRXGTSA-N |
| SMILES | C1CN(C[C@H]1N)S(=O)(=O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)