Products 16054-90-3
CAS 16054-90-3 is the registry number for 3-HYDROXY-3,3-DIPHENYL-N-(PYRIDIN-2-YL)PROPANAMIDE, 97%, 97%. Offered by: Chemat. Available pack sizes: 1mg.
3-hydroxy-3,3-diphenyl-N-pyridin-2-ylpropanamide (CAS 16054-90-3) is a chemical compound with the molecular formula C20H18N2O2 and a molecular weight of 318.4 g/mol. IUPAC name: 3-hydroxy-3,3-diphenyl-N-pyridin-2-ylpropanamide. InChIKey: XTHYHQFPPBENOY-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 3-hydroxy-3,3-diphenyl-N-pyridin-2-ylpropanamide |
| InChIKey | XTHYHQFPPBENOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)NC2=CC=CC=N2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)