Products 61755-75-7
CAS 61755-75-7 is the registry number for 3,6-Dimethoxy-8,8-dimethyl-2-phenyl-4H,8H-pyrano[2,3-f]chromen-4-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,6-dimethoxy-8,8-dimethyl-2-phenylpyrano[2,3-h]chromen-4-one (CAS 61755-75-7) is a chemical compound with the molecular formula C22H20O5 and a molecular weight of 364.4 g/mol. IUPAC name: 3,6-dimethoxy-8,8-dimethyl-2-phenylpyrano[2,3-h]chromen-4-one. InChIKey: HIMWSGBRGFKFJN-UHFFFAOYSA-N.
| Molecular formula | C22H20O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 3,6-dimethoxy-8,8-dimethyl-2-phenylpyrano[2,3-h]chromen-4-one |
| InChIKey | HIMWSGBRGFKFJN-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C3C(=CC(=C2O1)OC)C(=O)C(=C(O3)C4=CC=CC=C4)OC)C |
Computed by PubChem (NCBI)