CAS 16064-23-6 appears in our catalog under these names: 6-Amino-3-methylquinazolin-4(3H)-one, 6-Amino-3-methylquinazolin-4(3H)-one, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 100mg, 1g, 250mg.
6-amino-3-methylquinazolin-4-one (CAS 16064-23-6) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 6-amino-3-methylquinazolin-4-one. InChIKey: PKPUWVULEUYWLR-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 6-amino-3-methylquinazolin-4-one |
| InChIKey | PKPUWVULEUYWLR-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(C1=O)C=C(C=C2)N |
Computed by PubChem (NCBI)