CAS 1607300-19-5 is the registry number for (1-Methyl-2,3-dihydro-1H-indol-5-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1-methyl-2,3-dihydroindol-5-yl)methanamine;dihydrochloride (CAS 1607300-19-5) is a chemical compound with the molecular formula C10H16Cl2N2 and a molecular weight of 235.15 g/mol. IUPAC name: (1-methyl-2,3-dihydroindol-5-yl)methanamine;dihydrochloride. InChIKey: KYCLEEMVNNFUTO-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2 |
|---|---|
| Molecular weight | 235.15 g/mol |
| IUPAC name | (1-methyl-2,3-dihydroindol-5-yl)methanamine;dihydrochloride |
| InChIKey | KYCLEEMVNNFUTO-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C1C=CC(=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)