CAS 16089-46-6 appears in our catalog under these names: 5-Amino-2-(Pyrrolidin-1-yl)benzoic acid, 95+%, 5-Amino-2-pyrrolidin-1-yl-benzoic acid, 95+%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g.
5-amino-2-pyrrolidin-1-ylbenzoic acid (CAS 16089-46-6) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 5-amino-2-pyrrolidin-1-ylbenzoic acid. InChIKey: TVZSCEWHFAKJOE-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 5-amino-2-pyrrolidin-1-ylbenzoic acid |
| InChIKey | TVZSCEWHFAKJOE-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=C2)N)C(=O)O |
Computed by PubChem (NCBI)