CAS 1609194-88-8 is the registry number for (S)-2-(6-Methoxy-2,3-dihydrobenzofuran-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3S)-6-methoxy-2,3-dihydro-1-benzofuran-3-yl]acetic acid (CAS 1609194-88-8) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 2-[(3S)-6-methoxy-2,3-dihydro-1-benzofuran-3-yl]acetic acid. InChIKey: UPXQPBXFERQVDB-SSDOTTSWSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 2-[(3S)-6-methoxy-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
| InChIKey | UPXQPBXFERQVDB-SSDOTTSWSA-N |
| SMILES | COC1=CC2=C(C=C1)[C@@H](CO2)CC(=O)O |
Computed by PubChem (NCBI)