CAS 16096-33-6 appears in our catalog under these names: 1-Phenyl-1H-indole, 95-<97%, 1-Phenyl-1H-indole, ≥97-<99%, 1–Phenyl–1H–indole, 1-Phenyl-1H-indole, >98.0%(N), 1-Phenyl-1H-indole 98%. Offered by: Hoffman Fine Chemicals, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 1g, 5g.
1-phenylindole (CAS 16096-33-6) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: 1-phenylindole. InChIKey: YBFCBQMICVOSRW-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 1-phenylindole |
| InChIKey | YBFCBQMICVOSRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)