CAS 115213-33-7 appears in our catalog under these names: 2',5'–Dimethyl–(1,1':4',1''–terphenyl)–4,4''–dicarboxylic acid, 2',5'-Dimethyl-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid 98%, 2',5'-Dimethyl-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%, 98%, 2',5'-Dimethyl-[1,1',4',1''-terphenyl]-4,4''-dicarboxylic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
4-[4-(4-carboxyphenyl)-2,5-dimethylphenyl]benzoic acid (CAS 115213-33-7) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)-2,5-dimethylphenyl]benzoic acid. InChIKey: JZDSTRMMQZSYFF-UHFFFAOYSA-N.
| Molecular formula | C22H18O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)-2,5-dimethylphenyl]benzoic acid |
| InChIKey | JZDSTRMMQZSYFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C2=CC=C(C=C2)C(=O)O)C)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)