Products 2207526-73-4
CAS 2207526-73-4 is the registry number for 2',3'-Dimethyl-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(4-carboxyphenyl)-2,3-dimethylphenyl]benzoic acid (CAS 2207526-73-4) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)-2,3-dimethylphenyl]benzoic acid. InChIKey: SYNVDSAUHMTESW-UHFFFAOYSA-N.
| Molecular formula | C22H18O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)-2,3-dimethylphenyl]benzoic acid |
| InChIKey | SYNVDSAUHMTESW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)