Products 161095-11-0
CAS 161095-11-0 is the registry number for Neuroprotective agent 4. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-tert-butyl-1-(2-prop-2-ynoxyphenyl)methanimine oxide (CAS 161095-11-0) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: N-tert-butyl-1-(2-prop-2-ynoxyphenyl)methanimine oxide. InChIKey: XXJZYUXHMIVGHA-PTNGSMBKSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | N-tert-butyl-1-(2-prop-2-ynoxyphenyl)methanimine oxide |
| InChIKey | XXJZYUXHMIVGHA-PTNGSMBKSA-N |
| SMILES | CC(C)(C)/[N+](=C/C1=CC=CC=C1OCC#C)/[O-] |
Computed by PubChem (NCBI)
Synonyms:
Neuroprotective agent 4