Products 16110-27-3
CAS 16110-27-3 is the registry number for 6-Methoxy-3-methylquinazolin-4(3H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-methoxy-3-methylquinazolin-4-one (CAS 16110-27-3) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 6-methoxy-3-methylquinazolin-4-one. InChIKey: VPOXYLSXYTTZRL-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 6-methoxy-3-methylquinazolin-4-one |
| InChIKey | VPOXYLSXYTTZRL-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(C1=O)C=C(C=C2)OC |
Computed by PubChem (NCBI)