Products 161125-33-3
CAS 161125-33-3 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3,4-dihydroxyphenyl)propanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,4-dihydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 161125-33-3) is a chemical compound with the molecular formula C24H21NO6 and a molecular weight of 419.4 g/mol. IUPAC name: 3-(3,4-dihydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: NIJSCWCPASSJPI-UHFFFAOYSA-N.
| Molecular formula | C24H21NO6 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | 3-(3,4-dihydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | NIJSCWCPASSJPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC(=C(C=C4)O)O)C(=O)O |
Computed by PubChem (NCBI)