CAS 98270-32-7 appears in our catalog under these names: 4,4',4''-(Nitrilotris(methylene))tribenzoic acid, 98%, Tranexamic Acid Impurity 22, Aminomethylbenzoic Acid Impurity 2. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[[bis[(4-carboxyphenyl)methyl]amino]methyl]benzoic acid (CAS 98270-32-7) is a chemical compound with the molecular formula C24H21NO6 and a molecular weight of 419.4 g/mol. IUPAC name: 4-[[bis[(4-carboxyphenyl)methyl]amino]methyl]benzoic acid. InChIKey: GMOLNKRZAXUOCK-UHFFFAOYSA-N.
| Molecular formula | C24H21NO6 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | 4-[[bis[(4-carboxyphenyl)methyl]amino]methyl]benzoic acid |
| InChIKey | GMOLNKRZAXUOCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN(CC2=CC=C(C=C2)C(=O)O)CC3=CC=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)