Products 34069-90-4

CAS 34069-90-4 is the registry number for Trimethyl 2,2',2''-nitrilotribenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Methyl 2-(2-methoxycarbonyl-N-(2-methoxycarbonylphenyl)anilino)benzoate (CAS 34069-90-4) is a chemical compound with the molecular formula C24H21NO6 and a molecular weight of 419.4 g/mol. IUPAC name: methyl 2-(2-methoxycarbonyl-N-(2-methoxycarbonylphenyl)anilino)benzoate. InChIKey: SORZQJWJQYPSBK-UHFFFAOYSA-N.

Identity
Molecular formulaC24H21NO6
Molecular weight419.4 g/mol
IUPAC namemethyl 2-(2-methoxycarbonyl-N-(2-methoxycarbonylphenyl)anilino)benzoate
InChIKeySORZQJWJQYPSBK-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC=C1N(C2=CC=CC=C2C(=O)OC)C3=CC=CC=C3C(=O)OC

Computed by PubChem (NCBI)