Products 1076196-98-9

CAS 1076196-98-9 is the registry number for Fmoc-5-amino-2,4-dimethoxy-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(9H-fluoren-9-ylmethoxycarbonylamino)-2,4-dimethoxybenzoic acid (CAS 1076196-98-9) is a chemical compound with the molecular formula C24H21NO6 and a molecular weight of 419.4 g/mol. IUPAC name: 5-(9H-fluoren-9-ylmethoxycarbonylamino)-2,4-dimethoxybenzoic acid. InChIKey: XBMMIJUPPGWWFA-UHFFFAOYSA-N.

Identity
Molecular formulaC24H21NO6
Molecular weight419.4 g/mol
IUPAC name5-(9H-fluoren-9-ylmethoxycarbonylamino)-2,4-dimethoxybenzoic acid
InChIKeyXBMMIJUPPGWWFA-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)OC

Computed by PubChem (NCBI)