Products 2243512-40-3

CAS 2243512-40-3 is the registry number for 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4,5-dimethoxybenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,5-dimethoxybenzoic acid (CAS 2243512-40-3) is a chemical compound with the molecular formula C24H21NO6 and a molecular weight of 419.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,5-dimethoxybenzoic acid. InChIKey: XPNFLUAWMCAOOO-UHFFFAOYSA-N.

Identity
Molecular formulaC24H21NO6
Molecular weight419.4 g/mol
IUPAC name3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,5-dimethoxybenzoic acid
InChIKeyXPNFLUAWMCAOOO-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O

Computed by PubChem (NCBI)