CAS 17104-75-5 is the registry number for trimethyl 4,4',4''–nitrilotribenzoate. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Methyl 4-(4-methoxycarbonyl-N-(4-methoxycarbonylphenyl)anilino)benzoate (CAS 17104-75-5) is a chemical compound with the molecular formula C24H21NO6 and a molecular weight of 419.4 g/mol. IUPAC name: methyl 4-(4-methoxycarbonyl-N-(4-methoxycarbonylphenyl)anilino)benzoate. InChIKey: YSPJYGHSDRYWNZ-UHFFFAOYSA-N.
| Molecular formula | C24H21NO6 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | methyl 4-(4-methoxycarbonyl-N-(4-methoxycarbonylphenyl)anilino)benzoate |
| InChIKey | YSPJYGHSDRYWNZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)N(C2=CC=C(C=C2)C(=O)OC)C3=CC=C(C=C3)C(=O)OC |
Computed by PubChem (NCBI)