CAS 161125-36-6 appears in our catalog under these names: Fmoc-DL-isoSer-OH, 95%, Fmoc–DL–Isoser–OH, Fmoc-DL-IsoSer-OH 98% (contains~5.0% water), 3-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-hydroxypropanoic acid, 98%, 98%, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-hydroxypropanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250mg.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxypropanoic acid (CAS 161125-36-6) is a chemical compound with the molecular formula C18H17NO5 and a molecular weight of 327.3 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxypropanoic acid. InChIKey: OOFCRVWLJFLVCB-UHFFFAOYSA-N.
| Molecular formula | C18H17NO5 |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxypropanoic acid |
| InChIKey | OOFCRVWLJFLVCB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(C(=O)O)O |
Computed by PubChem (NCBI)