CAS 172721-23-2 appears in our catalog under these names: Fmoc-(S)-3-amino-2-hydroxypropionic acid, Fmoc-(s)-3-amino-2-hydroxypropionic acid, 95%, Fmoc-L-isoser-OH 98%, Fmoc-(S)-3-amino-2-hydroxypropionic acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat. Available pack sizes: 0,5g, 5g, 10g, 1g, 250mg.
(2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxypropanoic acid (CAS 172721-23-2) is a chemical compound with the molecular formula C18H17NO5 and a molecular weight of 327.3 g/mol. IUPAC name: (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxypropanoic acid. InChIKey: OOFCRVWLJFLVCB-INIZCTEOSA-N.
| Molecular formula | C18H17NO5 |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxypropanoic acid |
| InChIKey | OOFCRVWLJFLVCB-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)