Products 23437-10-7

CAS 23437-10-7 is the registry number for Benzocaine Acetylsalicylamide. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg.

Structural formula: {0} (CAS {1})

Ethyl 4-[(2-acetyloxybenzoyl)amino]benzoate (CAS 23437-10-7) is a chemical compound with the molecular formula C18H17NO5 and a molecular weight of 327.3 g/mol. IUPAC name: ethyl 4-[(2-acetyloxybenzoyl)amino]benzoate. InChIKey: RORGJEPJJCAMHK-UHFFFAOYSA-N.

Identity
Molecular formulaC18H17NO5
Molecular weight327.3 g/mol
IUPAC nameethyl 4-[(2-acetyloxybenzoyl)amino]benzoate
InChIKeyRORGJEPJJCAMHK-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2OC(=O)C

Computed by PubChem (NCBI)