CAS 116861-26-8 appears in our catalog under these names: Fmoc–D–Ser–OH, Fmoc-D-Ser-OH*H2O, Fmoc-D-Ser-OH 97%, Fmoc-D-Ser-OH, 98%, 98%, (((9H-Fluoren-9-yl)methoxy)carbonyl)-D-serine, 99.83%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 25g, 5g, 1g, 100g, 500g, 1000g, 10g, 1kg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid (CAS 116861-26-8) is a chemical compound with the molecular formula C18H17NO5 and a molecular weight of 327.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid. InChIKey: JZTKZVJMSCONAK-MRXNPFEDSA-N.
| Molecular formula | C18H17NO5 |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid |
| InChIKey | JZTKZVJMSCONAK-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CO)C(=O)O |
Computed by PubChem (NCBI)