Products 91920-58-0
CAS 91920-58-0 appears in our catalog under these names: (Z)-2-(3-(3,4-Dimethoxyphenyl)acrylamido)benzoic acid, 98%, Tranilast Impurity 1 (cis-Tranilast). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[[(Z)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoic acid (CAS 91920-58-0) is a chemical compound with the molecular formula C18H17NO5 and a molecular weight of 327.3 g/mol. IUPAC name: 2-[[(Z)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoic acid. InChIKey: NZHGWWWHIYHZNX-NTMALXAHSA-N.
| Molecular formula | C18H17NO5 |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | 2-[[(Z)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoic acid |
| InChIKey | NZHGWWWHIYHZNX-NTMALXAHSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C\C(=O)NC2=CC=CC=C2C(=O)O)OC |
Computed by PubChem (NCBI)