CAS 1612885-87-6 appears in our catalog under these names: cis-3-Hydroxy-1-phenylcyclobutane-1-carboxylic acid, 95%, rac-(1S,3S)-3-Hydroxy-1-phenylcyclobutane-1-carboxylic acid, (1s,3s)-3-hydroxy-1-phenylcyclobutane-1-carboxylic acid, 95%, 95%, (1s,3s)-3-Hydroxy-1-phenylcyclobutanecarboxylic acid, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg.
3-hydroxy-1-phenylcyclobutane-1-carboxylic acid (CAS 1612885-87-6) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 3-hydroxy-1-phenylcyclobutane-1-carboxylic acid. InChIKey: MBOADLJJMFPKKD-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 3-hydroxy-1-phenylcyclobutane-1-carboxylic acid |
| InChIKey | MBOADLJJMFPKKD-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C2=CC=CC=C2)C(=O)O)O |
Computed by PubChem (NCBI)