CAS 1613329-99-9 appears in our catalog under these names: 5–Chloro–2–methyl–3–nitrobenzaldehyde, 5-Chloro-2-methyl-3-nitrobenzaldehyde 98%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-chloro-2-methyl-3-nitrobenzaldehyde (CAS 1613329-99-9) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 5-chloro-2-methyl-3-nitrobenzaldehyde. InChIKey: GOCFEBVPKXFWEZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 5-chloro-2-methyl-3-nitrobenzaldehyde |
| InChIKey | GOCFEBVPKXFWEZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])Cl)C=O |
Computed by PubChem (NCBI)