Products 1613439-58-9
CAS 1613439-58-9 appears in our catalog under these names: Parbendazole-d3, D3-Parbendazole. Offered by: TRC, MedChemExpress, HPC Standards. Available pack sizes: 25mg, 5mg, 1mg, 1x10mg.
Trideuteriomethyl N-(6-butyl-1H-benzimidazol-2-yl)carbamate (CAS 1613439-58-9) is a chemical compound with the molecular formula C13H17N3O2 and a molecular weight of 250.31 g/mol. IUPAC name: trideuteriomethyl N-(6-butyl-1H-benzimidazol-2-yl)carbamate. InChIKey: YRWLZFXJFBZBEY-BMSJAHLVSA-N.
| Molecular formula | C13H17N3O2 |
|---|---|
| Molecular weight | 250.31 g/mol |
| IUPAC name | trideuteriomethyl N-(6-butyl-1H-benzimidazol-2-yl)carbamate |
| InChIKey | YRWLZFXJFBZBEY-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)CCCC |
Computed by PubChem (NCBI)