CAS 1613503-49-3 is the registry number for (Z)-3-(4-Chlorophenyl)-4,4,4-trifluorobut-2-enoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-3-(4-chlorophenyl)-4,4,4-trifluorobut-2-enoic acid (CAS 1613503-49-3) is a chemical compound with the molecular formula C10H6ClF3O2 and a molecular weight of 250.60 g/mol. IUPAC name: (Z)-3-(4-chlorophenyl)-4,4,4-trifluorobut-2-enoic acid. InChIKey: JHJWVWGLEWGSKZ-YVMONPNESA-N.
| Molecular formula | C10H6ClF3O2 |
|---|---|
| Molecular weight | 250.60 g/mol |
| IUPAC name | (Z)-3-(4-chlorophenyl)-4,4,4-trifluorobut-2-enoic acid |
| InChIKey | JHJWVWGLEWGSKZ-YVMONPNESA-N |
| SMILES | C1=CC(=CC=C1/C(=C/C(=O)O)/C(F)(F)F)Cl |
Computed by PubChem (NCBI)