CAS 163667-29-6 is the registry number for 2-Chloro-4,4,4-trifluoro-1-phenyl-butane-1,3-dione. Offered by: Fluorochem. Available pack sizes: 1g.
2-chloro-4,4,4-trifluoro-1-phenylbutane-1,3-dione (CAS 163667-29-6) is a chemical compound with the molecular formula C10H6ClF3O2 and a molecular weight of 250.60 g/mol. IUPAC name: 2-chloro-4,4,4-trifluoro-1-phenylbutane-1,3-dione. InChIKey: JIKVHDUUAACUNO-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF3O2 |
|---|---|
| Molecular weight | 250.60 g/mol |
| IUPAC name | 2-chloro-4,4,4-trifluoro-1-phenylbutane-1,3-dione |
| InChIKey | JIKVHDUUAACUNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(C(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)