Products 773132-29-9
CAS 773132-29-9 appears in our catalog under these names: 4-Chloro-2-(trifluoromethyl)cinnamic acid, 95%, 3-(4-Chloro-2-(trifluoromethyl)phenyl)acrylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.
(E)-3-[4-chloro-2-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 773132-29-9) is a chemical compound with the molecular formula C10H6ClF3O2 and a molecular weight of 250.60 g/mol. IUPAC name: (E)-3-[4-chloro-2-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: BRANIBQNEDUUCX-DUXPYHPUSA-N.
| Molecular formula | C10H6ClF3O2 |
|---|---|
| Molecular weight | 250.60 g/mol |
| IUPAC name | (E)-3-[4-chloro-2-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | BRANIBQNEDUUCX-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)