Products 682805-12-5

CAS 682805-12-5 is the registry number for 2-Chloro-5-(trifluoromethyl)cinnamic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 682805-12-5) is a chemical compound with the molecular formula C10H6ClF3O2 and a molecular weight of 250.60 g/mol. IUPAC name: (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: BRSLZIOZUPZJMY-DAFODLJHSA-N.

Identity
Molecular formulaC10H6ClF3O2
Molecular weight250.60 g/mol
IUPAC name(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoic acid
InChIKeyBRSLZIOZUPZJMY-DAFODLJHSA-N
SMILESC1=CC(=C(C=C1C(F)(F)F)/C=C/C(=O)O)Cl

Computed by PubChem (NCBI)