CAS 18931-60-7 appears in our catalog under these names: 1-(4-Chlorophenyl)-4,4,4-trifluoro-1,3-butanedione, 1–(4–Chlorophenyl)–4,4,4–trifluoro–1,3–butanedione, 1-(4-Chlorophenyl)-4,4,4-trifluoro-1,3-butanedione, >98.0%(GC)(T), 1-(4-Chlorophenyl)-4,4,4-trifluorobutane-1,3-dione, 97%, 97%, 1-(4-Chlorophenyl)-4,4,4-trifluoro-1,3-butanedione, 97%. Offered by: TRC, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 50g.
1-(4-chlorophenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 18931-60-7) is a chemical compound with the molecular formula C10H6ClF3O2 and a molecular weight of 250.60 g/mol. IUPAC name: 1-(4-chlorophenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: LJHFYVKVIIMXQM-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF3O2 |
|---|---|
| Molecular weight | 250.60 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | LJHFYVKVIIMXQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)